Oenothein B

Research use only, not for human use.

Oenothein B is a specific inhibitor of poly(ADP-ribose) glycohydrolase. Oenothein B shows antioxidant, anti-inflammatory, antifungal, anti-HCV, and antitumor properties.

Oenothein B is a specific inhibitor of poly(ADP-ribose) glycohydrolase. Oenothein B shows antioxidant, anti-inflammatory, antifungal, anti-HCV, and antitumor properties.(In Vitro):Oenothein B (15-45 μM; 24 hours) not only increased the level of intracellular reactive oxygen species (ROS) but also induced the upregulation of intracellular apoptotic triggers (cleavage caspase-3, PARP, cytochrome c level in the cytosol, Bax). Oenothein B (15-45 μM; 12-72 hours) had a dose- and time-dependent inhibition rate effect on A549 cells exposure. Oenothein B (15-45 μM; 24 hours) effectively inhibited the proliferation of A549 cells by inducing apoptosis and arresting cells at the G1 stage.(In Vivo):In ICR mice, Oenothein B (100-300 mg/kg; p.o.) reduced neuroinflammation in the brain during systemic inflammation.

——

Apoptosis

Apoptosis

Apoptosis

——

——

104987-36-2

1569.1

C68H48O44

>98% (HPLC)

——

OC1=C(C(C(O)=C2O)=C(C=C2O)C3=O)C(C(O[C@H]4[C@H](OC(C5=CC(O)=C(O)C(O)=C5)=O)[C@@H](OC(C(C=C6O)=C(C(O)=C6O)OC7=C(O)C(O)=C8C9=C7)=O)[C@H](O)O[C@@H]4CO3)=O)=CC(OC(C(O)=C%10O)=C(C=C%10O)C(O[C@@H]%11[C@@H](OC(C%12=CC(O)=C(O)C(O)=C%12)=O)[C@H](OC(C%13=C8C(O)=C(O)C(O)=C%13)=O)[C@@H](COC9=O)O[C@H]%11O)=O)=C1O

——

(-20℃)

With Ice Pack

≥ 2 years